C27H31F3O5S — CID 142845803
2-methylbut-3-en-2-yl 4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate (PubChem CID 142845803) has the molecular formula C27H31F3O5S and a molecular weight of 524.60 g/mol. Its IUPAC name is 2-methylbut-3-en-2-yl 4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate.
| Compound Name | 2-methylbut-3-en-2-yl 4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate |
|---|---|
| PubChem CID | 142845803 |
| Molecular Formula | C27H31F3O5S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 2-methylbut-3-en-2-yl 4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate |
| SMILES | C=CC(C)(C)OC(=O)C1(S(=O)(=O)c2ccc(-c3ccc(CCCC(F)(F)F)cc3)cc2)CCOCC1 |
| InChI | InChI=1S/C27H31F3O5S/c1-4-25(2,3)35-24(31)26(16-18-34-19-17-26)36(32,33)23-13-11-22(12-14-23)21-9-7-20(8-10-21)6-5-15-27(28,29)30/h4,7-14H,1,5-6,15-19H2,2-3H3 |
| InChIKey | FJIOZGPGQMCJIM-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|