C28H34F3NO5S — CID 142845938
N-(oxan-2-yloxy)-1-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylcyclohexane-1-carboxamide (PubChem CID 142845938) has the molecular formula C28H34F3NO5S and a molecular weight of 553.64 g/mol. Its IUPAC name is N-(oxan-2-yloxy)-1-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylcyclohexane-1-carboxamide.
| Compound Name | N-(oxan-2-yloxy)-1-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 142845938 |
| Molecular Formula | C28H34F3NO5S |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | N-(oxan-2-yloxy)-1-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylcyclohexane-1-carboxamide |
| SMILES | O=C(NOC1CCCCO1)C1(S(=O)(=O)c2ccc(-c3ccc(CCCC(F)(F)F)cc3)cc2)CCCCC1 |
| InChI | InChI=1S/C28H34F3NO5S/c29-28(30,31)19-6-7-21-9-11-22(12-10-21)23-13-15-24(16-14-23)38(34,35)27(17-3-1-4-18-27)26(33)32-37-25-8-2-5-20-36-25/h9-16,25H,1-8,17-20H2,(H,32,33) |
| InChIKey | QIRISTBQVWNQHC-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|