C11H17F6N — CID 142845958
1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-propylpiperidine (PubChem CID 142845958) has the molecular formula C11H17F6N and a molecular weight of 277.25 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-propylpiperidine.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-propylpiperidine |
|---|---|
| PubChem CID | 142845958 |
| Molecular Formula | C11H17F6N |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-propylpiperidine |
| SMILES | CCCC1CCN(C(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H17F6N/c1-2-3-8-4-6-18(7-5-8)9(10(12,13)14)11(15,16)17/h8-9H,2-7H2,1H3 |
| InChIKey | VCYRRLVPTZZPKM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |