C27H24N4O5S — CID 142846224
3-[[4-[(4-methyl-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]anilino)methyl]benzoyl]amino]propanoic acid (PubChem CID 142846224) has the molecular formula C27H24N4O5S and a molecular weight of 516.58 g/mol. Its IUPAC name is 3-[[4-[(4-methyl-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]anilino)methyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[(4-methyl-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]anilino)methyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 142846224 |
| Molecular Formula | C27H24N4O5S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 3-[[4-[(4-methyl-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]anilino)methyl]benzoyl]amino]propanoic acid |
| SMILES | Cc1ccc(N(Cc2ccc(C(=O)NCCC(=O)O)cc2)c2nc(-c3ccc([N+](=O)[O-])cc3)cs2)cc1 |
| InChI | InChI=1S/C27H24N4O5S/c1-18-2-10-22(11-3-18)30(16-19-4-6-21(7-5-19)26(34)28-15-14-25(32)33)27-29-24(17-37-27)20-8-12-23(13-9-20)31(35)36/h2-13,17H,14-16H2,1H3,(H,28,34)(H,32,33) |
| InChIKey | GJCCPSDVRPVFSL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 125.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|