C18H26O3 — CID 142846432
2,3-dihydro-1,4-benzodioxine;ethane;(3E)-3-ethoxyhexa-1,3,5-triene (PubChem CID 142846432) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxine;ethane;(3E)-3-ethoxyhexa-1,3,5-triene.
| Compound Name | 2,3-dihydro-1,4-benzodioxine;ethane;(3E)-3-ethoxyhexa-1,3,5-triene |
|---|---|
| PubChem CID | 142846432 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxine;ethane;(3E)-3-ethoxyhexa-1,3,5-triene |
| SMILES | C=C/C=C(\C=C)OCC.CC.c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C8H8O2.C8H12O.C2H6/c1-2-4-8-7(3-1)9-5-6-10-8;1-4-7-8(5-2)9-6-3;1-2/h1-4H,5-6H2;4-5,7H,1-2,6H2,3H3;1-2H3/b;8-7+; |
| InChIKey | ZCFCAHCSPLBMOX-BVUSFOFSSA-N |
| XLogP | 4.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|