About 4,6-dimethylpyran-2,5-dione
4,6-dimethylpyran-2,5-dione (PubChem CID 142846765) has the molecular formula C7H8O3
and a molecular weight of 140.14 g/mol. Its IUPAC name is 4,6-dimethylpyran-2,5-dione.
Molecular Properties
| Compound Name | 4,6-dimethylpyran-2,5-dione |
| PubChem CID | 142846765 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | 4,6-dimethylpyran-2,5-dione |
| SMILES | CC1=CC(=O)OC(C)C1=O |
| InChI | InChI=1S/C7H8O3/c1-4-3-6(8)10-5(2)7(4)9/h3,5H,1-2H3 |
| InChIKey | ZHDYOEWIELZKME-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-dimethylpyran-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethylpyran-2,5-dione?
The IUPAC name of 4,6-dimethylpyran-2,5-dione (CID 142846765) is 4,6-dimethylpyran-2,5-dione.
What is the SMILES notation for 4,6-dimethylpyran-2,5-dione?
The canonical SMILES for 4,6-dimethylpyran-2,5-dione is CC1=CC(=O)OC(C)C1=O.
What is the InChIKey of 4,6-dimethylpyran-2,5-dione?
The InChIKey is ZHDYOEWIELZKME-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3/c1-4-3-6(8)10-5(2)7(4)9/h3,5H,1-2H3.
What are the key properties of 4,6-dimethylpyran-2,5-dione?
4,6-dimethylpyran-2,5-dione has a molecular weight of 140.14 g/mol, XLogP of 0.45, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethylpyran-2,5-dione is sourced from PubChem (CID 142846765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).