About acetic acid;2-(7-chloro-1-oxoisoquinolin-2-yl)-N-(4-fluoro-3-oxobutan-2-yl)acetamide;ethane
acetic acid;2-(7-chloro-1-oxoisoquinolin-2-yl)-N-(4-fluoro-3-oxobutan-2-yl)acetamide;ethane (PubChem CID 142847421) has the molecular formula C19H24ClFN2O5
and a molecular weight of 414.86 g/mol. Its IUPAC name is acetic acid;2-(7-chloro-1-oxoisoquinolin-2-yl)-N-(4-fluoro-3-oxobutan-2-yl)acetamide;ethane.
Molecular Properties
| Compound Name | acetic acid;2-(7-chloro-1-oxoisoquinolin-2-yl)-N-(4-fluoro-3-oxobutan-2-yl)acetamide;ethane |
| PubChem CID | 142847421 |
| Molecular Formula | C19H24ClFN2O5 |
| Molecular Weight | 414.86 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | acetic acid;2-(7-chloro-1-oxoisoquinolin-2-yl)-N-(4-fluoro-3-oxobutan-2-yl)acetamide;ethane |
| SMILES | CC.CC(=O)O.CC(NC(=O)Cn1ccc2ccc(Cl)cc2c1=O)C(=O)CF |
| InChI | InChI=1S/C15H14ClFN2O3.C2H4O2.C2H6/c1-9(13(20)7-17)18-14(21)8-19-5-4-10-2-3-11(16)6-12(10)15(19)22;1-2(3)4;1-2/h2-6,9H,7-8H2,1H3,(H,18,21);1H3,(H,3,4);1-2H3 |
| InChIKey | UFLVXRIZPIWGTA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.86 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze acetic acid;2-(7-chloro-1-oxoisoquinolin-2-yl)-N-(4-fluoro-3-oxobutan-2-yl)acetamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-(7-chloro-1-oxoisoquinolin-2-yl)-N-(4-fluoro-3-oxobutan-2-yl)acetamide;ethane?
The IUPAC name of acetic acid;2-(7-chloro-1-oxoisoquinolin-2-yl)-N-(4-fluoro-3-oxobutan-2-yl)acetamide;ethane (CID 142847421) is acetic acid;2-(7-chloro-1-oxoisoquinolin-2-yl)-N-(4-fluoro-3-oxobutan-2-yl)acetamide;ethane.
What is the SMILES notation for acetic acid;2-(7-chloro-1-oxoisoquinolin-2-yl)-N-(4-fluoro-3-oxobutan-2-yl)acetamide;ethane?
The canonical SMILES for acetic acid;2-(7-chloro-1-oxoisoquinolin-2-yl)-N-(4-fluoro-3-oxobutan-2-yl)acetamide;ethane is CC.CC(=O)O.CC(NC(=O)Cn1ccc2ccc(Cl)cc2c1=O)C(=O)CF.
What is the InChIKey of acetic acid;2-(7-chloro-1-oxoisoquinolin-2-yl)-N-(4-fluoro-3-oxobutan-2-yl)acetamide;ethane?
The InChIKey is UFLVXRIZPIWGTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClFN2O3.C2H4O2.C2H6/c1-9(13(20)7-17)18-14(21)8-19-5-4-10-2-3-11(16)6-12(10)15(19)22;1-2(3)4;1-2/h2-6,9H,7-8H2,1H3,(H,18,21);1H3,(H,3,4);1-2H3.
What are the key properties of acetic acid;2-(7-chloro-1-oxoisoquinolin-2-yl)-N-(4-fluoro-3-oxobutan-2-yl)acetamide;ethane?
acetic acid;2-(7-chloro-1-oxoisoquinolin-2-yl)-N-(4-fluoro-3-oxobutan-2-yl)acetamide;ethane has a molecular weight of 414.86 g/mol, XLogP of 2.82, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-(7-chloro-1-oxoisoquinolin-2-yl)-N-(4-fluoro-3-oxobutan-2-yl)acetamide;ethane is sourced from PubChem (CID 142847421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).