C15H26ClN — CID 142847554
N-[(2E,4E)-4-[(E)-1-chloroprop-1-enyl]hepta-2,4,6-trien-3-yl]methanimine;ethane (PubChem CID 142847554) has the molecular formula C15H26ClN and a molecular weight of 255.83 g/mol. Its IUPAC name is N-[(2E,4E)-4-[(E)-1-chloroprop-1-enyl]hepta-2,4,6-trien-3-yl]methanimine;ethane.
| Compound Name | N-[(2E,4E)-4-[(E)-1-chloroprop-1-enyl]hepta-2,4,6-trien-3-yl]methanimine;ethane |
|---|---|
| PubChem CID | 142847554 |
| Molecular Formula | C15H26ClN |
| Molecular Weight | 255.83 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | N-[(2E,4E)-4-[(E)-1-chloroprop-1-enyl]hepta-2,4,6-trien-3-yl]methanimine;ethane |
| SMILES | C=C/C=C(C(/Cl)=C\C)\C(=C/C)N=C.CC.CC |
| InChI | InChI=1S/C11H14ClN.2C2H6/c1-5-8-9(10(12)6-2)11(7-3)13-4;2*1-2/h5-8H,1,4H2,2-3H3;2*1-2H3/b9-8-,10-6+,11-7+;; |
| InChIKey | UYTDOVAVQJKXLL-DIPNPEJFSA-N |
| XLogP | 5.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.83 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|