About 3-acetyloxyhexadecanoic acid
3-acetyloxyhexadecanoic acid (PubChem CID 14284759) has the molecular formula C18H34O4
and a molecular weight of 314.47 g/mol. Its IUPAC name is 3-acetyloxyhexadecanoic acid.
Molecular Properties
| Compound Name | 3-acetyloxyhexadecanoic acid |
| PubChem CID | 14284759 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | 3-acetyloxyhexadecanoic acid |
| SMILES | CCCCCCCCCCCCCC(CC(=O)O)OC(C)=O |
| InChI | InChI=1S/C18H34O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-17(15-18(20)21)22-16(2)19/h17H,3-15H2,1-2H3,(H,20,21) |
| InChIKey | YGOMZEGUVXYKIH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyloxyhexadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyloxyhexadecanoic acid?
The IUPAC name of 3-acetyloxyhexadecanoic acid (CID 14284759) is 3-acetyloxyhexadecanoic acid.
What is the SMILES notation for 3-acetyloxyhexadecanoic acid?
The canonical SMILES for 3-acetyloxyhexadecanoic acid is CCCCCCCCCCCCCC(CC(=O)O)OC(C)=O.
What is the InChIKey of 3-acetyloxyhexadecanoic acid?
The InChIKey is YGOMZEGUVXYKIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-17(15-18(20)21)22-16(2)19/h17H,3-15H2,1-2H3,(H,20,21).
What are the key properties of 3-acetyloxyhexadecanoic acid?
3-acetyloxyhexadecanoic acid has a molecular weight of 314.47 g/mol, XLogP of 5.09, 15 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyloxyhexadecanoic acid is sourced from PubChem (CID 14284759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).