About (Z)-N-methoxy-5-(methoxymethyl)-1-methylpyrrolidin-3-imine;4-phenylbenzaldehyde
(Z)-N-methoxy-5-(methoxymethyl)-1-methylpyrrolidin-3-imine;4-phenylbenzaldehyde (PubChem CID 142847929) has the molecular formula C21H26N2O3
and a molecular weight of 354.45 g/mol. Its IUPAC name is (Z)-N-methoxy-5-(methoxymethyl)-1-methylpyrrolidin-3-imine;4-phenylbenzaldehyde.
Molecular Properties
| Compound Name | (Z)-N-methoxy-5-(methoxymethyl)-1-methylpyrrolidin-3-imine;4-phenylbenzaldehyde |
| PubChem CID | 142847929 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (Z)-N-methoxy-5-(methoxymethyl)-1-methylpyrrolidin-3-imine;4-phenylbenzaldehyde |
| SMILES | COCC1C/C(=N/OC)CN1C.O=Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H10O.C8H16N2O2/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;1-10-5-7(9-12-3)4-8(10)6-11-2/h1-10H;8H,4-6H2,1-3H3/b;9-7- |
| InChIKey | BQUMEYUXPGCDNL-QFWHIOIXSA-N |
| XLogP | 3.51 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-methoxy-5-(methoxymethyl)-1-methylpyrrolidin-3-imine;4-phenylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-methoxy-5-(methoxymethyl)-1-methylpyrrolidin-3-imine;4-phenylbenzaldehyde?
The IUPAC name of (Z)-N-methoxy-5-(methoxymethyl)-1-methylpyrrolidin-3-imine;4-phenylbenzaldehyde (CID 142847929) is (Z)-N-methoxy-5-(methoxymethyl)-1-methylpyrrolidin-3-imine;4-phenylbenzaldehyde.
What is the SMILES notation for (Z)-N-methoxy-5-(methoxymethyl)-1-methylpyrrolidin-3-imine;4-phenylbenzaldehyde?
The canonical SMILES for (Z)-N-methoxy-5-(methoxymethyl)-1-methylpyrrolidin-3-imine;4-phenylbenzaldehyde is COCC1C/C(=N/OC)CN1C.O=Cc1ccc(-c2ccccc2)cc1.
What is the InChIKey of (Z)-N-methoxy-5-(methoxymethyl)-1-methylpyrrolidin-3-imine;4-phenylbenzaldehyde?
The InChIKey is BQUMEYUXPGCDNL-QFWHIOIXSA-N. The full InChI is InChI=1S/C13H10O.C8H16N2O2/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;1-10-5-7(9-12-3)4-8(10)6-11-2/h1-10H;8H,4-6H2,1-3H3/b;9-7-.
What are the key properties of (Z)-N-methoxy-5-(methoxymethyl)-1-methylpyrrolidin-3-imine;4-phenylbenzaldehyde?
(Z)-N-methoxy-5-(methoxymethyl)-1-methylpyrrolidin-3-imine;4-phenylbenzaldehyde has a molecular weight of 354.45 g/mol, XLogP of 3.51, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-methoxy-5-(methoxymethyl)-1-methylpyrrolidin-3-imine;4-phenylbenzaldehyde is sourced from PubChem (CID 142847929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).