C11H16O4 — CID 142847964
methyl (5E)-4-ethyl-5-ethylidene-6-hydroxy-4H-pyran-3-carboxylate (PubChem CID 142847964) has the molecular formula C11H16O4 and a molecular weight of 212.25 g/mol. Its IUPAC name is methyl (5E)-4-ethyl-5-ethylidene-6-hydroxy-4H-pyran-3-carboxylate.
| Compound Name | methyl (5E)-4-ethyl-5-ethylidene-6-hydroxy-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 142847964 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | methyl (5E)-4-ethyl-5-ethylidene-6-hydroxy-4H-pyran-3-carboxylate |
| SMILES | C/C=C1/C(O)OC=C(C(=O)OC)C1CC |
| InChI | InChI=1S/C11H16O4/c1-4-7-8(5-2)11(13)15-6-9(7)10(12)14-3/h5-7,11,13H,4H2,1-3H3/b8-5+ |
| InChIKey | DXRNOUZOVIWLSL-VMPITWQZSA-N |
| XLogP | 1.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|