C21H29NO — CID 142848391
1-[4-ethenyl-3-[methyl-[(2E)-3-methylpenta-2,4-dien-2-yl]amino]cyclohepta-1,3,5-trien-1-yl]ethanone;prop-1-ene (PubChem CID 142848391) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is 1-[4-ethenyl-3-[methyl-[(2E)-3-methylpenta-2,4-dien-2-yl]amino]cyclohepta-1,3,5-trien-1-yl]ethanone;prop-1-ene.
| Compound Name | 1-[4-ethenyl-3-[methyl-[(2E)-3-methylpenta-2,4-dien-2-yl]amino]cyclohepta-1,3,5-trien-1-yl]ethanone;prop-1-ene |
|---|---|
| PubChem CID | 142848391 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 1-[4-ethenyl-3-[methyl-[(2E)-3-methylpenta-2,4-dien-2-yl]amino]cyclohepta-1,3,5-trien-1-yl]ethanone;prop-1-ene |
| SMILES | C=CC.C=CC1=C(N(C)/C(C)=C(\C)C=C)C=C(C(C)=O)CC=C1 |
| InChI | InChI=1S/C18H23NO.C3H6/c1-7-13(3)14(4)19(6)18-12-17(15(5)20)11-9-10-16(18)8-2;1-3-2/h7-10,12H,1-2,11H2,3-6H3;3H,1H2,2H3/b14-13+; |
| InChIKey | ZRFDVKRYTSFVTB-IERUDJENSA-N |
| XLogP | 5.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|