C20H21N — CID 142848419
(2E,3Z,5Z,8Z,10Z)-2-but-3-enylidene-3-ethylidene-12-methylidene-7H-cyclodeca[b]pyridine (PubChem CID 142848419) has the molecular formula C20H21N and a molecular weight of 275.39 g/mol. Its IUPAC name is (2E,3Z,5Z,8Z,10Z)-2-but-3-enylidene-3-ethylidene-12-methylidene-7H-cyclodeca[b]pyridine.
| Compound Name | (2E,3Z,5Z,8Z,10Z)-2-but-3-enylidene-3-ethylidene-12-methylidene-7H-cyclodeca[b]pyridine |
|---|---|
| PubChem CID | 142848419 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | (2E,3Z,5Z,8Z,10Z)-2-but-3-enylidene-3-ethylidene-12-methylidene-7H-cyclodeca[b]pyridine |
| SMILES | C=CC/C=c1/nc2c(c/c1=C/C)/C=C\C/C=C\C=C/C2=C |
| InChI | InChI=1S/C20H21N/c1-4-6-14-19-17(5-2)15-18-13-11-9-7-8-10-12-16(3)20(18)21-19/h4-5,7-8,10-15H,1,3,6,9H2,2H3/b8-7-,12-10-,13-11-,17-5-,19-14+ |
| InChIKey | AITOVIHPJSNKLO-IPPLLUCISA-N |
| XLogP | 3.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|