About formaldehyde;4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]aniline
formaldehyde;4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]aniline (PubChem CID 142848559) has the molecular formula C19H18F3N3O2
and a molecular weight of 377.37 g/mol. Its IUPAC name is formaldehyde;4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]aniline.
Molecular Properties
| Compound Name | formaldehyde;4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]aniline |
| PubChem CID | 142848559 |
| Molecular Formula | C19H18F3N3O2 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | formaldehyde;4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]aniline |
| SMILES | C=O.C=O.Cc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C17H14F3N3.2CH2O/c1-11-2-4-12(5-3-11)15-10-16(17(18,19)20)22-23(15)14-8-6-13(21)7-9-14;2*1-2/h2-10H,21H2,1H3;2*1H2 |
| InChIKey | PTLZSAKWJYSINU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]aniline?
The IUPAC name of formaldehyde;4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]aniline (CID 142848559) is formaldehyde;4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]aniline.
What is the SMILES notation for formaldehyde;4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]aniline?
The canonical SMILES for formaldehyde;4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]aniline is C=O.C=O.Cc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(N)cc2)cc1.
What is the InChIKey of formaldehyde;4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]aniline?
The InChIKey is PTLZSAKWJYSINU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F3N3.2CH2O/c1-11-2-4-12(5-3-11)15-10-16(17(18,19)20)22-23(15)14-8-6-13(21)7-9-14;2*1-2/h2-10H,21H2,1H3;2*1H2.
What are the key properties of formaldehyde;4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]aniline?
formaldehyde;4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]aniline has a molecular weight of 377.37 g/mol, XLogP of 4.08, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]aniline is sourced from PubChem (CID 142848559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).