C20H32O — CID 142848737
(2E,4E)-1-cyclohexa-1,5-dien-1-yl-2,5,6-trimethylnona-2,4-dien-1-one;ethane (PubChem CID 142848737) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is (2E,4E)-1-cyclohexa-1,5-dien-1-yl-2,5,6-trimethylnona-2,4-dien-1-one;ethane.
| Compound Name | (2E,4E)-1-cyclohexa-1,5-dien-1-yl-2,5,6-trimethylnona-2,4-dien-1-one;ethane |
|---|---|
| PubChem CID | 142848737 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (2E,4E)-1-cyclohexa-1,5-dien-1-yl-2,5,6-trimethylnona-2,4-dien-1-one;ethane |
| SMILES | CC.CCCC(C)/C(C)=C/C=C(\C)C(=O)C1=CCCC=C1 |
| InChI | InChI=1S/C18H26O.C2H6/c1-5-9-14(2)15(3)12-13-16(4)18(19)17-10-7-6-8-11-17;1-2/h7,10-14H,5-6,8-9H2,1-4H3;1-2H3/b15-12+,16-13+; |
| InChIKey | UUVPGBSVIVMMAE-WYGWYXPLSA-N |
| XLogP | 6.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|