C25H46O — CID 142849800
ethane;10-methyl-17-[(2R)-pentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-13-ol (PubChem CID 142849800) has the molecular formula C25H46O and a molecular weight of 362.64 g/mol. Its IUPAC name is ethane;10-methyl-17-[(2R)-pentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-13-ol.
| Compound Name | ethane;10-methyl-17-[(2R)-pentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-13-ol |
|---|---|
| PubChem CID | 142849800 |
| Molecular Formula | C25H46O |
| Molecular Weight | 362.64 g/mol |
| Exact Mass | 362.35 |
| IUPAC Name | ethane;10-methyl-17-[(2R)-pentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-13-ol |
| SMILES | CC.CCC[C@@H](C)C1CCC2C3CCC4CCCCC4(C)C3CCC21O |
| InChI | InChI=1S/C23H40O.C2H6/c1-4-7-16(2)19-11-12-21-18-10-9-17-8-5-6-14-22(17,3)20(18)13-15-23(19,21)24;1-2/h16-21,24H,4-15H2,1-3H3;1-2H3/t16-,17?,18?,19?,20?,21?,22?,23?;/m1./s1 |
| InChIKey | AHGFPVQNHXHGHU-XXEDFCIMSA-N |
| XLogP | 7.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.64 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |