C10H16O2 — CID 142850190
2-[(3Z,5Z)-hepta-3,5-dien-2-yl]-1,3-dioxolane (PubChem CID 142850190) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-[(3Z,5Z)-hepta-3,5-dien-2-yl]-1,3-dioxolane.
| Compound Name | 2-[(3Z,5Z)-hepta-3,5-dien-2-yl]-1,3-dioxolane |
|---|---|
| PubChem CID | 142850190 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2-[(3Z,5Z)-hepta-3,5-dien-2-yl]-1,3-dioxolane |
| SMILES | C/C=C\C=C/C(C)C1OCCO1 |
| InChI | InChI=1S/C10H16O2/c1-3-4-5-6-9(2)10-11-7-8-12-10/h3-6,9-10H,7-8H2,1-2H3/b4-3-,6-5- |
| InChIKey | JTILGBHRISZWKN-OUPQRBNQSA-N |
| XLogP | 2.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|