C38H40N4O6P2 — CID 142850203
(2Z)-N-methylpenta-2,4-dien-1-imine;methyl(pyridin-2-yloxy)phosphinous acid;[2-(2-propylbenzoyl)phenyl] dipyridin-2-yl phosphite (PubChem CID 142850203) has the molecular formula C38H40N4O6P2 and a molecular weight of 710.71 g/mol. Its IUPAC name is (2Z)-N-methylpenta-2,4-dien-1-imine;methyl(pyridin-2-yloxy)phosphinous acid;[2-(2-propylbenzoyl)phenyl] dipyridin-2-yl phosphite.
| Compound Name | (2Z)-N-methylpenta-2,4-dien-1-imine;methyl(pyridin-2-yloxy)phosphinous acid;[2-(2-propylbenzoyl)phenyl] dipyridin-2-yl phosphite |
|---|---|
| PubChem CID | 142850203 |
| Molecular Formula | C38H40N4O6P2 |
| Molecular Weight | 710.71 g/mol |
| Exact Mass | 710.24 |
| IUPAC Name | (2Z)-N-methylpenta-2,4-dien-1-imine;methyl(pyridin-2-yloxy)phosphinous acid;[2-(2-propylbenzoyl)phenyl] dipyridin-2-yl phosphite |
| SMILES | C=C/C=C\C=N\C.CCCc1ccccc1C(=O)c1ccccc1OP(Oc1ccccn1)Oc1ccccn1.CP(O)Oc1ccccn1 |
| InChI | InChI=1S/C26H23N2O4P.C6H8NO2P.C6H9N/c1-2-11-20-12-3-4-13-21(20)26(29)22-14-5-6-15-23(22)30-33(31-24-16-7-9-18-27-24)32-25-17-8-10-19-28-25;1-10(8)9-6-4-2-3-5-7-6;1-3-4-5-6-7-2/h3-10,12-19H,2,11H2,1H3;2-5,8H,1H3;3-6H,1H2,2H3/b;;5-4-,7-6+ |
| InChIKey | XPMQSYRLPYQCJI-RUZUDQPRSA-N |
| XLogP | 9.25 |
| TPSA | 125.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.71 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|