C30H29BrN4O5 — CID 142850775
N-[1-[(3aS)-1-(4-aminobenzoyl)-3-oxo-2,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-3-bromobenzamide (PubChem CID 142850775) has the molecular formula C30H29BrN4O5 and a molecular weight of 605.49 g/mol. Its IUPAC name is N-[1-[(3aS)-1-(4-aminobenzoyl)-3-oxo-2,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-3-bromobenzamide.
| Compound Name | N-[1-[(3aS)-1-(4-aminobenzoyl)-3-oxo-2,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-3-bromobenzamide |
|---|---|
| PubChem CID | 142850775 |
| Molecular Formula | C30H29BrN4O5 |
| Molecular Weight | 605.49 g/mol |
| Exact Mass | 604.13 |
| IUPAC Name | N-[1-[(3aS)-1-(4-aminobenzoyl)-3-oxo-2,3a,5,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-3-bromobenzamide |
| SMILES | Nc1ccc(C(=O)N2CC(=O)[C@@H]3C2CCCN3C(=O)C(Cc2ccc(O)cc2)NC(=O)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C30H29BrN4O5/c31-21-4-1-3-20(16-21)28(38)33-24(15-18-6-12-23(36)13-7-18)30(40)34-14-2-5-25-27(34)26(37)17-35(25)29(39)19-8-10-22(32)11-9-19/h1,3-4,6-13,16,24-25,27,36H,2,5,14-15,17,32H2,(H,33,38)/t24?,25?,27-/m0/s1 |
| InChIKey | WGVNZTKTBUMKJR-ONJSCSTBSA-N |
| XLogP | 3.16 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|