About ethene;1-[(3E)-penta-1,3-dien-3-yl]piperidine-4-carbaldehyde
ethene;1-[(3E)-penta-1,3-dien-3-yl]piperidine-4-carbaldehyde (PubChem CID 142850990) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is ethene;1-[(3E)-penta-1,3-dien-3-yl]piperidine-4-carbaldehyde.
Molecular Properties
| Compound Name | ethene;1-[(3E)-penta-1,3-dien-3-yl]piperidine-4-carbaldehyde |
| PubChem CID | 142850990 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | ethene;1-[(3E)-penta-1,3-dien-3-yl]piperidine-4-carbaldehyde |
| SMILES | C=C.C=C/C(=C\C)N1CCC(C=O)CC1 |
| InChI | InChI=1S/C11H17NO.C2H4/c1-3-11(4-2)12-7-5-10(9-13)6-8-12;1-2/h3-4,9-10H,1,5-8H2,2H3;1-2H2/b11-4+; |
| InChIKey | VNUCHJZUVHRMNJ-SODSUQDMSA-N |
| XLogP | 2.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethene;1-[(3E)-penta-1,3-dien-3-yl]piperidine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;1-[(3E)-penta-1,3-dien-3-yl]piperidine-4-carbaldehyde?
The IUPAC name of ethene;1-[(3E)-penta-1,3-dien-3-yl]piperidine-4-carbaldehyde (CID 142850990) is ethene;1-[(3E)-penta-1,3-dien-3-yl]piperidine-4-carbaldehyde.
What is the SMILES notation for ethene;1-[(3E)-penta-1,3-dien-3-yl]piperidine-4-carbaldehyde?
The canonical SMILES for ethene;1-[(3E)-penta-1,3-dien-3-yl]piperidine-4-carbaldehyde is C=C.C=C/C(=C\C)N1CCC(C=O)CC1.
What is the InChIKey of ethene;1-[(3E)-penta-1,3-dien-3-yl]piperidine-4-carbaldehyde?
The InChIKey is VNUCHJZUVHRMNJ-SODSUQDMSA-N. The full InChI is InChI=1S/C11H17NO.C2H4/c1-3-11(4-2)12-7-5-10(9-13)6-8-12;1-2/h3-4,9-10H,1,5-8H2,2H3;1-2H2/b11-4+;.
What are the key properties of ethene;1-[(3E)-penta-1,3-dien-3-yl]piperidine-4-carbaldehyde?
ethene;1-[(3E)-penta-1,3-dien-3-yl]piperidine-4-carbaldehyde has a molecular weight of 207.32 g/mol, XLogP of 2.79, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;1-[(3E)-penta-1,3-dien-3-yl]piperidine-4-carbaldehyde is sourced from PubChem (CID 142850990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).