C28H34N4O8S — CID 142851016
N-[(2S)-4-methyl-1-[2-methyl-5-(3-methylsulfonylbenzoyl)-3-oxo-1,5-diazocan-1-yl]-1-oxopentan-2-yl]-4-nitrobenzamide (PubChem CID 142851016) has the molecular formula C28H34N4O8S and a molecular weight of 586.67 g/mol. Its IUPAC name is N-[(2S)-4-methyl-1-[2-methyl-5-(3-methylsulfonylbenzoyl)-3-oxo-1,5-diazocan-1-yl]-1-oxopentan-2-yl]-4-nitrobenzamide.
| Compound Name | N-[(2S)-4-methyl-1-[2-methyl-5-(3-methylsulfonylbenzoyl)-3-oxo-1,5-diazocan-1-yl]-1-oxopentan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 142851016 |
| Molecular Formula | C28H34N4O8S |
| Molecular Weight | 586.67 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | N-[(2S)-4-methyl-1-[2-methyl-5-(3-methylsulfonylbenzoyl)-3-oxo-1,5-diazocan-1-yl]-1-oxopentan-2-yl]-4-nitrobenzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)N1CCCN(C(=O)c2cccc(S(C)(=O)=O)c2)CC(=O)C1C |
| InChI | InChI=1S/C28H34N4O8S/c1-18(2)15-24(29-26(34)20-9-11-22(12-10-20)32(37)38)28(36)31-14-6-13-30(17-25(33)19(31)3)27(35)21-7-5-8-23(16-21)41(4,39)40/h5,7-12,16,18-19,24H,6,13-15,17H2,1-4H3,(H,29,34)/t19?,24-/m0/s1 |
| InChIKey | MRIDWMVINDHZBG-WIIYFNMSSA-N |
| XLogP | 2.48 |
| TPSA | 164.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.67 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|