About 2-(trimethyl-λ4-sulfanyl)ethyl 4-fluoro-3-hydroxycyclohexane-1-carboxylate
2-(trimethyl-λ4-sulfanyl)ethyl 4-fluoro-3-hydroxycyclohexane-1-carboxylate (PubChem CID 142851137) has the molecular formula C12H23FO3S
and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-(trimethyl-λ4-sulfanyl)ethyl 4-fluoro-3-hydroxycyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 2-(trimethyl-λ4-sulfanyl)ethyl 4-fluoro-3-hydroxycyclohexane-1-carboxylate |
| PubChem CID | 142851137 |
| Molecular Formula | C12H23FO3S |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-(trimethyl-λ4-sulfanyl)ethyl 4-fluoro-3-hydroxycyclohexane-1-carboxylate |
| SMILES | CS(C)(C)CCOC(=O)C1CCC(F)C(O)C1 |
| InChI | InChI=1S/C12H23FO3S/c1-17(2,3)7-6-16-12(15)9-4-5-10(13)11(14)8-9/h9-11,14H,4-8H2,1-3H3 |
| InChIKey | MOLFNNFZSLCNAN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(trimethyl-λ4-sulfanyl)ethyl 4-fluoro-3-hydroxycyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trimethyl-λ4-sulfanyl)ethyl 4-fluoro-3-hydroxycyclohexane-1-carboxylate?
The IUPAC name of 2-(trimethyl-λ4-sulfanyl)ethyl 4-fluoro-3-hydroxycyclohexane-1-carboxylate (CID 142851137) is 2-(trimethyl-λ4-sulfanyl)ethyl 4-fluoro-3-hydroxycyclohexane-1-carboxylate.
What is the SMILES notation for 2-(trimethyl-λ4-sulfanyl)ethyl 4-fluoro-3-hydroxycyclohexane-1-carboxylate?
The canonical SMILES for 2-(trimethyl-λ4-sulfanyl)ethyl 4-fluoro-3-hydroxycyclohexane-1-carboxylate is CS(C)(C)CCOC(=O)C1CCC(F)C(O)C1.
What is the InChIKey of 2-(trimethyl-λ4-sulfanyl)ethyl 4-fluoro-3-hydroxycyclohexane-1-carboxylate?
The InChIKey is MOLFNNFZSLCNAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23FO3S/c1-17(2,3)7-6-16-12(15)9-4-5-10(13)11(14)8-9/h9-11,14H,4-8H2,1-3H3.
What are the key properties of 2-(trimethyl-λ4-sulfanyl)ethyl 4-fluoro-3-hydroxycyclohexane-1-carboxylate?
2-(trimethyl-λ4-sulfanyl)ethyl 4-fluoro-3-hydroxycyclohexane-1-carboxylate has a molecular weight of 266.38 g/mol, XLogP of 1.72, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trimethyl-λ4-sulfanyl)ethyl 4-fluoro-3-hydroxycyclohexane-1-carboxylate is sourced from PubChem (CID 142851137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).