About N,2-dimethylprop-2-en-1-imine;ethane
N,2-dimethylprop-2-en-1-imine;ethane (PubChem CID 142851393) has the molecular formula C9H21N
and a molecular weight of 143.27 g/mol. Its IUPAC name is N,2-dimethylprop-2-en-1-imine;ethane.
Molecular Properties
| Compound Name | N,2-dimethylprop-2-en-1-imine;ethane |
| PubChem CID | 142851393 |
| Molecular Formula | C9H21N |
| Molecular Weight | 143.27 g/mol |
| Exact Mass | 143.17 |
| IUPAC Name | N,2-dimethylprop-2-en-1-imine;ethane |
| SMILES | C=C(C)/C=N/C.CC.CC |
| InChI | InChI=1S/C5H9N.2C2H6/c1-5(2)4-6-3;2*1-2/h4H,1H2,2-3H3;2*1-2H3/b6-4+;; |
| InChIKey | XQMWJZNCEFMSCQ-SLNOCBGISA-N |
| XLogP | 3.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,2-dimethylprop-2-en-1-imine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethylprop-2-en-1-imine;ethane?
The IUPAC name of N,2-dimethylprop-2-en-1-imine;ethane (CID 142851393) is N,2-dimethylprop-2-en-1-imine;ethane.
What is the SMILES notation for N,2-dimethylprop-2-en-1-imine;ethane?
The canonical SMILES for N,2-dimethylprop-2-en-1-imine;ethane is C=C(C)/C=N/C.CC.CC.
What is the InChIKey of N,2-dimethylprop-2-en-1-imine;ethane?
The InChIKey is XQMWJZNCEFMSCQ-SLNOCBGISA-N. The full InChI is InChI=1S/C5H9N.2C2H6/c1-5(2)4-6-3;2*1-2/h4H,1H2,2-3H3;2*1-2H3/b6-4+;;.
What are the key properties of N,2-dimethylprop-2-en-1-imine;ethane?
N,2-dimethylprop-2-en-1-imine;ethane has a molecular weight of 143.27 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethylprop-2-en-1-imine;ethane is sourced from PubChem (CID 142851393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).