C10H9Cl2NO2 — CID 142851512
5,7-dichloro-3-methyl-1,8a-dihydroquinoline-2,4-diol (PubChem CID 142851512) has the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. Its IUPAC name is 5,7-dichloro-3-methyl-1,8a-dihydroquinoline-2,4-diol.
| Compound Name | 5,7-dichloro-3-methyl-1,8a-dihydroquinoline-2,4-diol |
|---|---|
| PubChem CID | 142851512 |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | 5,7-dichloro-3-methyl-1,8a-dihydroquinoline-2,4-diol |
| SMILES | CC1=C(O)NC2C=C(Cl)C=C(Cl)C2=C1O |
| InChI | InChI=1S/C10H9Cl2NO2/c1-4-9(14)8-6(12)2-5(11)3-7(8)13-10(4)15/h2-3,7,13-15H,1H3 |
| InChIKey | USUZBFDZPCSJDG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |