About 3-aminobenzenesulfonic acid;methanol;3-methylnaphthalene-2-sulfonic acid
3-aminobenzenesulfonic acid;methanol;3-methylnaphthalene-2-sulfonic acid (PubChem CID 142851571) has the molecular formula C18H21NO7S2
and a molecular weight of 427.50 g/mol. Its IUPAC name is 3-aminobenzenesulfonic acid;methanol;3-methylnaphthalene-2-sulfonic acid.
Molecular Properties
| Compound Name | 3-aminobenzenesulfonic acid;methanol;3-methylnaphthalene-2-sulfonic acid |
| PubChem CID | 142851571 |
| Molecular Formula | C18H21NO7S2 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 3-aminobenzenesulfonic acid;methanol;3-methylnaphthalene-2-sulfonic acid |
| SMILES | CO.Cc1cc2ccccc2cc1S(=O)(=O)O.Nc1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C11H10O3S.C6H7NO3S.CH4O/c1-8-6-9-4-2-3-5-10(9)7-11(8)15(12,13)14;7-5-2-1-3-6(4-5)11(8,9)10;1-2/h2-7H,1H3,(H,12,13,14);1-4H,7H2,(H,8,9,10);2H,1H3 |
| InChIKey | DRRGSERAXCEWEM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 154.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-aminobenzenesulfonic acid;methanol;3-methylnaphthalene-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminobenzenesulfonic acid;methanol;3-methylnaphthalene-2-sulfonic acid?
The IUPAC name of 3-aminobenzenesulfonic acid;methanol;3-methylnaphthalene-2-sulfonic acid (CID 142851571) is 3-aminobenzenesulfonic acid;methanol;3-methylnaphthalene-2-sulfonic acid.
What is the SMILES notation for 3-aminobenzenesulfonic acid;methanol;3-methylnaphthalene-2-sulfonic acid?
The canonical SMILES for 3-aminobenzenesulfonic acid;methanol;3-methylnaphthalene-2-sulfonic acid is CO.Cc1cc2ccccc2cc1S(=O)(=O)O.Nc1cccc(S(=O)(=O)O)c1.
What is the InChIKey of 3-aminobenzenesulfonic acid;methanol;3-methylnaphthalene-2-sulfonic acid?
The InChIKey is DRRGSERAXCEWEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O3S.C6H7NO3S.CH4O/c1-8-6-9-4-2-3-5-10(9)7-11(8)15(12,13)14;7-5-2-1-3-6(4-5)11(8,9)10;1-2/h2-7H,1H3,(H,12,13,14);1-4H,7H2,(H,8,9,10);2H,1H3.
What are the key properties of 3-aminobenzenesulfonic acid;methanol;3-methylnaphthalene-2-sulfonic acid?
3-aminobenzenesulfonic acid;methanol;3-methylnaphthalene-2-sulfonic acid has a molecular weight of 427.50 g/mol, XLogP of 2.52, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminobenzenesulfonic acid;methanol;3-methylnaphthalene-2-sulfonic acid is sourced from PubChem (CID 142851571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).