About methyl 2-[[(2S,3R)-2-methyl-4-methylidene-5-oxooxolane-3-carbonyl]amino]acetate
methyl 2-[[(2S,3R)-2-methyl-4-methylidene-5-oxooxolane-3-carbonyl]amino]acetate (PubChem CID 142851755) has the molecular formula C10H13NO5
and a molecular weight of 227.22 g/mol. Its IUPAC name is methyl 2-[[(2S,3R)-2-methyl-4-methylidene-5-oxooxolane-3-carbonyl]amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[[(2S,3R)-2-methyl-4-methylidene-5-oxooxolane-3-carbonyl]amino]acetate |
| PubChem CID | 142851755 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | methyl 2-[[(2S,3R)-2-methyl-4-methylidene-5-oxooxolane-3-carbonyl]amino]acetate |
| SMILES | C=C1C(=O)O[C@@H](C)[C@@H]1C(=O)NCC(=O)OC |
| InChI | InChI=1S/C10H13NO5/c1-5-8(6(2)16-10(5)14)9(13)11-4-7(12)15-3/h6,8H,1,4H2,2-3H3,(H,11,13)/t6-,8+/m0/s1 |
| InChIKey | ZOLQPSPTXBNUTO-POYBYMJQSA-N |
| XLogP | -0.61 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[[(2S,3R)-2-methyl-4-methylidene-5-oxooxolane-3-carbonyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(2S,3R)-2-methyl-4-methylidene-5-oxooxolane-3-carbonyl]amino]acetate?
The IUPAC name of methyl 2-[[(2S,3R)-2-methyl-4-methylidene-5-oxooxolane-3-carbonyl]amino]acetate (CID 142851755) is methyl 2-[[(2S,3R)-2-methyl-4-methylidene-5-oxooxolane-3-carbonyl]amino]acetate.
What is the SMILES notation for methyl 2-[[(2S,3R)-2-methyl-4-methylidene-5-oxooxolane-3-carbonyl]amino]acetate?
The canonical SMILES for methyl 2-[[(2S,3R)-2-methyl-4-methylidene-5-oxooxolane-3-carbonyl]amino]acetate is C=C1C(=O)O[C@@H](C)[C@@H]1C(=O)NCC(=O)OC.
What is the InChIKey of methyl 2-[[(2S,3R)-2-methyl-4-methylidene-5-oxooxolane-3-carbonyl]amino]acetate?
The InChIKey is ZOLQPSPTXBNUTO-POYBYMJQSA-N. The full InChI is InChI=1S/C10H13NO5/c1-5-8(6(2)16-10(5)14)9(13)11-4-7(12)15-3/h6,8H,1,4H2,2-3H3,(H,11,13)/t6-,8+/m0/s1.
What are the key properties of methyl 2-[[(2S,3R)-2-methyl-4-methylidene-5-oxooxolane-3-carbonyl]amino]acetate?
methyl 2-[[(2S,3R)-2-methyl-4-methylidene-5-oxooxolane-3-carbonyl]amino]acetate has a molecular weight of 227.22 g/mol, XLogP of -0.61, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(2S,3R)-2-methyl-4-methylidene-5-oxooxolane-3-carbonyl]amino]acetate is sourced from PubChem (CID 142851755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).