C20H23N3O2 — CID 142851910
3-[6-(4-ethoxyphenyl)-1,5,7-trimethylpyrrolo[3,4-d]pyridazin-4-yl]propanal (PubChem CID 142851910) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 3-[6-(4-ethoxyphenyl)-1,5,7-trimethylpyrrolo[3,4-d]pyridazin-4-yl]propanal.
| Compound Name | 3-[6-(4-ethoxyphenyl)-1,5,7-trimethylpyrrolo[3,4-d]pyridazin-4-yl]propanal |
|---|---|
| PubChem CID | 142851910 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 3-[6-(4-ethoxyphenyl)-1,5,7-trimethylpyrrolo[3,4-d]pyridazin-4-yl]propanal |
| SMILES | CCOc1ccc(-n2c(C)c3c(C)nnc(CCC=O)c3c2C)cc1 |
| InChI | InChI=1S/C20H23N3O2/c1-5-25-17-10-8-16(9-11-17)23-14(3)19-13(2)21-22-18(7-6-12-24)20(19)15(23)4/h8-12H,5-7H2,1-4H3 |
| InChIKey | SIRISFDHQZHSCX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|