C27H33N5O2 — CID 142852061
6-(4-ethoxy-2-methoxyphenyl)-1,5-dimethyl-4-N-(4-phenylbutyl)pyrrolo[3,4-d]pyridazine-4,7-diamine (PubChem CID 142852061) has the molecular formula C27H33N5O2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 6-(4-ethoxy-2-methoxyphenyl)-1,5-dimethyl-4-N-(4-phenylbutyl)pyrrolo[3,4-d]pyridazine-4,7-diamine.
| Compound Name | 6-(4-ethoxy-2-methoxyphenyl)-1,5-dimethyl-4-N-(4-phenylbutyl)pyrrolo[3,4-d]pyridazine-4,7-diamine |
|---|---|
| PubChem CID | 142852061 |
| Molecular Formula | C27H33N5O2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 6-(4-ethoxy-2-methoxyphenyl)-1,5-dimethyl-4-N-(4-phenylbutyl)pyrrolo[3,4-d]pyridazine-4,7-diamine |
| SMILES | CCOc1ccc(-n2c(C)c3c(NCCCCc4ccccc4)nnc(C)c3c2N)c(OC)c1 |
| InChI | InChI=1S/C27H33N5O2/c1-5-34-21-14-15-22(23(17-21)33-4)32-19(3)25-24(26(32)28)18(2)30-31-27(25)29-16-10-9-13-20-11-7-6-8-12-20/h6-8,11-12,14-15,17H,5,9-10,13,16,28H2,1-4H3,(H,29,31) |
| InChIKey | YRTAQDXHJHYFPE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|