About ethane;4-methylcyclohepta-1,4,6-triene-1-carbonitrile
ethane;4-methylcyclohepta-1,4,6-triene-1-carbonitrile (PubChem CID 142852205) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is ethane;4-methylcyclohepta-1,4,6-triene-1-carbonitrile.
Analyze ethane;4-methylcyclohepta-1,4,6-triene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methylcyclohepta-1,4,6-triene-1-carbonitrile?
The IUPAC name of ethane;4-methylcyclohepta-1,4,6-triene-1-carbonitrile (CID 142852205) is ethane;4-methylcyclohepta-1,4,6-triene-1-carbonitrile.
What is the SMILES notation for ethane;4-methylcyclohepta-1,4,6-triene-1-carbonitrile?
The canonical SMILES for ethane;4-methylcyclohepta-1,4,6-triene-1-carbonitrile is CC.CC1=CC=CC(C#N)=CC1.
What is the InChIKey of ethane;4-methylcyclohepta-1,4,6-triene-1-carbonitrile?
The InChIKey is PEXIVJDRJNZWQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C2H6/c1-8-3-2-4-9(7-10)6-5-8;1-2/h2-4,6H,5H2,1H3;1-2H3.
What are the key properties of ethane;4-methylcyclohepta-1,4,6-triene-1-carbonitrile?
ethane;4-methylcyclohepta-1,4,6-triene-1-carbonitrile has a molecular weight of 161.25 g/mol, XLogP of 3.37, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methylcyclohepta-1,4,6-triene-1-carbonitrile is sourced from PubChem (CID 142852205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).