C26H30N6O — CID 142853298
N-(3-methoxybutyl)-6-methyl-2-[1-[(2-prop-2-enylphenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]pyrimidin-4-amine (PubChem CID 142853298) has the molecular formula C26H30N6O and a molecular weight of 442.57 g/mol. Its IUPAC name is N-(3-methoxybutyl)-6-methyl-2-[1-[(2-prop-2-enylphenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]pyrimidin-4-amine.
| Compound Name | N-(3-methoxybutyl)-6-methyl-2-[1-[(2-prop-2-enylphenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 142853298 |
| Molecular Formula | C26H30N6O |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | N-(3-methoxybutyl)-6-methyl-2-[1-[(2-prop-2-enylphenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]pyrimidin-4-amine |
| SMILES | C=CCc1ccccc1Cn1nc(-c2nc(C)cc(NCCC(C)OC)n2)c2cccnc21 |
| InChI | InChI=1S/C26H30N6O/c1-5-9-20-10-6-7-11-21(20)17-32-26-22(12-8-14-28-26)24(31-32)25-29-18(2)16-23(30-25)27-15-13-19(3)33-4/h5-8,10-12,14,16,19H,1,9,13,15,17H2,2-4H3,(H,27,29,30) |
| InChIKey | PTICUMKBAOCELA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|