About 4-chloro-1-phosphanylpyrrolo[2,3-b]pyridin-5-amine;ethane
4-chloro-1-phosphanylpyrrolo[2,3-b]pyridin-5-amine;ethane (PubChem CID 142854318) has the molecular formula C9H13ClN3P
and a molecular weight of 229.65 g/mol. Its IUPAC name is 4-chloro-1-phosphanylpyrrolo[2,3-b]pyridin-5-amine;ethane.
Molecular Properties
| Compound Name | 4-chloro-1-phosphanylpyrrolo[2,3-b]pyridin-5-amine;ethane |
| PubChem CID | 142854318 |
| Molecular Formula | C9H13ClN3P |
| Molecular Weight | 229.65 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 4-chloro-1-phosphanylpyrrolo[2,3-b]pyridin-5-amine;ethane |
| SMILES | CC.Nc1cnc2c(ccn2P)c1Cl |
| InChI | InChI=1S/C7H7ClN3P.C2H6/c8-6-4-1-2-11(12)7(4)10-3-5(6)9;1-2/h1-3H,9,12H2;1-2H3 |
| InChIKey | BUHWEYNPLXVXNP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.65 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1-phosphanylpyrrolo[2,3-b]pyridin-5-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-phosphanylpyrrolo[2,3-b]pyridin-5-amine;ethane?
The IUPAC name of 4-chloro-1-phosphanylpyrrolo[2,3-b]pyridin-5-amine;ethane (CID 142854318) is 4-chloro-1-phosphanylpyrrolo[2,3-b]pyridin-5-amine;ethane.
What is the SMILES notation for 4-chloro-1-phosphanylpyrrolo[2,3-b]pyridin-5-amine;ethane?
The canonical SMILES for 4-chloro-1-phosphanylpyrrolo[2,3-b]pyridin-5-amine;ethane is CC.Nc1cnc2c(ccn2P)c1Cl.
What is the InChIKey of 4-chloro-1-phosphanylpyrrolo[2,3-b]pyridin-5-amine;ethane?
The InChIKey is BUHWEYNPLXVXNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN3P.C2H6/c8-6-4-1-2-11(12)7(4)10-3-5(6)9;1-2/h1-3H,9,12H2;1-2H3.
What are the key properties of 4-chloro-1-phosphanylpyrrolo[2,3-b]pyridin-5-amine;ethane?
4-chloro-1-phosphanylpyrrolo[2,3-b]pyridin-5-amine;ethane has a molecular weight of 229.65 g/mol, XLogP of 2.94, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-phosphanylpyrrolo[2,3-b]pyridin-5-amine;ethane is sourced from PubChem (CID 142854318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).