C14H26N+ — CID 142854698
triethyl-[(2E,5Z)-octa-2,5,7-trien-3-yl]azanium (PubChem CID 142854698) has the molecular formula C14H26N+ and a molecular weight of 208.37 g/mol. Its IUPAC name is triethyl-[(2E,5Z)-octa-2,5,7-trien-3-yl]azanium.
| Compound Name | triethyl-[(2E,5Z)-octa-2,5,7-trien-3-yl]azanium |
|---|---|
| PubChem CID | 142854698 |
| Molecular Formula | C14H26N+ |
| Molecular Weight | 208.37 g/mol |
| Exact Mass | 208.21 |
| IUPAC Name | triethyl-[(2E,5Z)-octa-2,5,7-trien-3-yl]azanium |
| SMILES | C=C/C=C\C/C(=C\C)[N+](CC)(CC)CC |
| InChI | InChI=1S/C14H26N/c1-6-11-12-13-14(7-2)15(8-3,9-4)10-5/h6-7,11-12H,1,8-10,13H2,2-5H3/q+1/b12-11-,14-7+ |
| InChIKey | ZZVHLHMPZWSYKB-XSLLEFITSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|