C24H38N2 — CID 142854977
2,7-ditert-butyl-5-[(1E,3Z)-3-[(ethylideneamino)methyl]hexa-1,3-dienyl]cyclohepta-1,4,6-trien-1-amine (PubChem CID 142854977) has the molecular formula C24H38N2 and a molecular weight of 354.58 g/mol. Its IUPAC name is 2,7-ditert-butyl-5-[(1E,3Z)-3-[(ethylideneamino)methyl]hexa-1,3-dienyl]cyclohepta-1,4,6-trien-1-amine.
| Compound Name | 2,7-ditert-butyl-5-[(1E,3Z)-3-[(ethylideneamino)methyl]hexa-1,3-dienyl]cyclohepta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 142854977 |
| Molecular Formula | C24H38N2 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | 2,7-ditert-butyl-5-[(1E,3Z)-3-[(ethylideneamino)methyl]hexa-1,3-dienyl]cyclohepta-1,4,6-trien-1-amine |
| SMILES | C/C=N/CC(=C\CC)/C=C/C1=CCC(C(C)(C)C)=C(N)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C24H38N2/c1-9-11-19(17-26-10-2)13-12-18-14-15-20(23(3,4)5)22(25)21(16-18)24(6,7)8/h10-14,16H,9,15,17,25H2,1-8H3/b13-12+,19-11-,26-10+ |
| InChIKey | IQFVXTNGLNNJNV-NUQWRDBGSA-N |
| XLogP | 6.53 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|