C24H22O11S3 — CID 142855008
ethane;3-hydroxy-7-hydroxysulfanylnaphthalene-2-carboxylic acid;3-hydroxy-7-hydroxysulfanyl-5-sulfonaphthalene-2-carboxylic acid (PubChem CID 142855008) has the molecular formula C24H22O11S3 and a molecular weight of 582.63 g/mol. Its IUPAC name is ethane;3-hydroxy-7-hydroxysulfanylnaphthalene-2-carboxylic acid;3-hydroxy-7-hydroxysulfanyl-5-sulfonaphthalene-2-carboxylic acid.
| Compound Name | ethane;3-hydroxy-7-hydroxysulfanylnaphthalene-2-carboxylic acid;3-hydroxy-7-hydroxysulfanyl-5-sulfonaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 142855008 |
| Molecular Formula | C24H22O11S3 |
| Molecular Weight | 582.63 g/mol |
| Exact Mass | 582.03 |
| IUPAC Name | ethane;3-hydroxy-7-hydroxysulfanylnaphthalene-2-carboxylic acid;3-hydroxy-7-hydroxysulfanyl-5-sulfonaphthalene-2-carboxylic acid |
| SMILES | CC.O=C(O)c1cc2cc(SO)cc(S(=O)(=O)O)c2cc1O.O=C(O)c1cc2cc(SO)ccc2cc1O |
| InChI | InChI=1S/C11H8O7S2.C11H8O4S.C2H6/c12-9-4-7-5(2-8(9)11(13)14)1-6(19-15)3-10(7)20(16,17)18;12-10-5-6-1-2-8(16-15)3-7(6)4-9(10)11(13)14;1-2/h1-4,12,15H,(H,13,14)(H,16,17,18);1-5,12,15H,(H,13,14);1-2H3 |
| InChIKey | DMEWGXCAOUXYJH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 209.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.63 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|