C26H26N4OS2 — CID 142855073
2-[[2-benzylsulfanyl-6-[(4-cyclohepta-1,4,6-trien-1-ylphenyl)sulfanylamino]pyrimidin-4-yl]amino]ethanol (PubChem CID 142855073) has the molecular formula C26H26N4OS2 and a molecular weight of 474.66 g/mol. Its IUPAC name is 2-[[2-benzylsulfanyl-6-[(4-cyclohepta-1,4,6-trien-1-ylphenyl)sulfanylamino]pyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-[[2-benzylsulfanyl-6-[(4-cyclohepta-1,4,6-trien-1-ylphenyl)sulfanylamino]pyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 142855073 |
| Molecular Formula | C26H26N4OS2 |
| Molecular Weight | 474.66 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 2-[[2-benzylsulfanyl-6-[(4-cyclohepta-1,4,6-trien-1-ylphenyl)sulfanylamino]pyrimidin-4-yl]amino]ethanol |
| SMILES | OCCNc1cc(NSc2ccc(C3=CCC=CC=C3)cc2)nc(SCc2ccccc2)n1 |
| InChI | InChI=1S/C26H26N4OS2/c31-17-16-27-24-18-25(29-26(28-24)32-19-20-8-4-3-5-9-20)30-33-23-14-12-22(13-15-23)21-10-6-1-2-7-11-21/h1-6,8-15,18,31H,7,16-17,19H2,(H2,27,28,29,30) |
| InChIKey | GLAYFTLXLGAOJL-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.66 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|