C26H27N2O3PS — CID 142855150
N-cyclopropyl-3-[3-ethenyl-4-[methyl-(3-phosphanylphenyl)sulfonylamino]phenyl]-4-methylbenzamide (PubChem CID 142855150) has the molecular formula C26H27N2O3PS and a molecular weight of 478.55 g/mol. Its IUPAC name is N-cyclopropyl-3-[3-ethenyl-4-[methyl-(3-phosphanylphenyl)sulfonylamino]phenyl]-4-methylbenzamide.
| Compound Name | N-cyclopropyl-3-[3-ethenyl-4-[methyl-(3-phosphanylphenyl)sulfonylamino]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 142855150 |
| Molecular Formula | C26H27N2O3PS |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | N-cyclopropyl-3-[3-ethenyl-4-[methyl-(3-phosphanylphenyl)sulfonylamino]phenyl]-4-methylbenzamide |
| SMILES | C=Cc1cc(-c2cc(C(=O)NC3CC3)ccc2C)ccc1N(C)S(=O)(=O)c1cccc(P)c1 |
| InChI | InChI=1S/C26H27N2O3PS/c1-4-18-14-19(24-15-20(9-8-17(24)2)26(29)27-21-11-12-21)10-13-25(18)28(3)33(30,31)23-7-5-6-22(32)16-23/h4-10,13-16,21H,1,11-12,32H2,2-3H3,(H,27,29) |
| InChIKey | WTOHWQSVWYXRNF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|