C22H23N3O2 — CID 142855166
N-cyclopropyl-3-[1-(2-methoxyprop-2-enyl)indazol-5-yl]-4-methylbenzamide (PubChem CID 142855166) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is N-cyclopropyl-3-[1-(2-methoxyprop-2-enyl)indazol-5-yl]-4-methylbenzamide.
| Compound Name | N-cyclopropyl-3-[1-(2-methoxyprop-2-enyl)indazol-5-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 142855166 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-cyclopropyl-3-[1-(2-methoxyprop-2-enyl)indazol-5-yl]-4-methylbenzamide |
| SMILES | C=C(Cn1ncc2cc(-c3cc(C(=O)NC4CC4)ccc3C)ccc21)OC |
| InChI | InChI=1S/C22H23N3O2/c1-14-4-5-17(22(26)24-19-7-8-19)11-20(14)16-6-9-21-18(10-16)12-23-25(21)13-15(2)27-3/h4-6,9-12,19H,2,7-8,13H2,1,3H3,(H,24,26) |
| InChIKey | FVVJEKGNFDFRAQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|