C26H41N3O — CID 142855594
(E)-N-[3-(4-ethylpiperidin-1-yl)propyl]-2-methyl-4-[(Z)-prop-1-enyl]iminobut-2-enamide;3-methylcyclohepta-1,3,5-triene (PubChem CID 142855594) has the molecular formula C26H41N3O and a molecular weight of 411.63 g/mol. Its IUPAC name is (E)-N-[3-(4-ethylpiperidin-1-yl)propyl]-2-methyl-4-[(Z)-prop-1-enyl]iminobut-2-enamide;3-methylcyclohepta-1,3,5-triene.
| Compound Name | (E)-N-[3-(4-ethylpiperidin-1-yl)propyl]-2-methyl-4-[(Z)-prop-1-enyl]iminobut-2-enamide;3-methylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 142855594 |
| Molecular Formula | C26H41N3O |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.32 |
| IUPAC Name | (E)-N-[3-(4-ethylpiperidin-1-yl)propyl]-2-methyl-4-[(Z)-prop-1-enyl]iminobut-2-enamide;3-methylcyclohepta-1,3,5-triene |
| SMILES | C/C=C\N=C\C=C(/C)C(=O)NCCCN1CCC(CC)CC1.CC1=CC=CCC=C1 |
| InChI | InChI=1S/C18H31N3O.C8H10/c1-4-10-19-12-7-16(3)18(22)20-11-6-13-21-14-8-17(5-2)9-15-21;1-8-6-4-2-3-5-7-8/h4,7,10,12,17H,5-6,8-9,11,13-15H2,1-3H3,(H,20,22);2,4-7H,3H2,1H3/b10-4-,16-7+,19-12+; |
| InChIKey | CFHIDJAZKLVKSF-ZTNNCGMRSA-N |
| XLogP | 5.61 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|