C24H23NO3S — CID 142855803
4-ethenyl-2-(3-hydroxy-2,2-dimethylpropyl)-5-methylthiochromeno[3,4-f]isoquinoline-1,3-dione (PubChem CID 142855803) has the molecular formula C24H23NO3S and a molecular weight of 405.52 g/mol. Its IUPAC name is 4-ethenyl-2-(3-hydroxy-2,2-dimethylpropyl)-5-methylthiochromeno[3,4-f]isoquinoline-1,3-dione.
| Compound Name | 4-ethenyl-2-(3-hydroxy-2,2-dimethylpropyl)-5-methylthiochromeno[3,4-f]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 142855803 |
| Molecular Formula | C24H23NO3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 4-ethenyl-2-(3-hydroxy-2,2-dimethylpropyl)-5-methylthiochromeno[3,4-f]isoquinoline-1,3-dione |
| SMILES | C=Cc1c(=O)n(CC(C)(C)CO)c(=O)c2ccc3c4ccccc4sc(C)c3c12 |
| InChI | InChI=1S/C24H23NO3S/c1-5-15-21-18(23(28)25(22(15)27)12-24(3,4)13-26)11-10-17-16-8-6-7-9-19(16)29-14(2)20(17)21/h5-11,26H,1,12-13H2,2-4H3 |
| InChIKey | JDWSBVXFJJZZTN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|