About 1-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 4-O-fluoro butanedioate
1-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 4-O-fluoro butanedioate (PubChem CID 142856537) has the molecular formula C11H13FO8
and a molecular weight of 292.22 g/mol. Its IUPAC name is 1-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 4-O-fluoro butanedioate.
Molecular Properties
| Compound Name | 1-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 4-O-fluoro butanedioate |
| PubChem CID | 142856537 |
| Molecular Formula | C11H13FO8 |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 1-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 4-O-fluoro butanedioate |
| SMILES | O=C(CCC(=O)OCC(O)C1CC(=O)C(O)=C1O)OF |
| InChI | InChI=1S/C11H13FO8/c12-20-9(16)2-1-8(15)19-4-7(14)5-3-6(13)11(18)10(5)17/h5,7,14,17-18H,1-4H2 |
| InChIKey | RKKAQMISHCISKI-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 4-O-fluoro butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 4-O-fluoro butanedioate?
The IUPAC name of 1-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 4-O-fluoro butanedioate (CID 142856537) is 1-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 4-O-fluoro butanedioate.
What is the SMILES notation for 1-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 4-O-fluoro butanedioate?
The canonical SMILES for 1-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 4-O-fluoro butanedioate is O=C(CCC(=O)OCC(O)C1CC(=O)C(O)=C1O)OF.
What is the InChIKey of 1-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 4-O-fluoro butanedioate?
The InChIKey is RKKAQMISHCISKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FO8/c12-20-9(16)2-1-8(15)19-4-7(14)5-3-6(13)11(18)10(5)17/h5,7,14,17-18H,1-4H2.
What are the key properties of 1-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 4-O-fluoro butanedioate?
1-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 4-O-fluoro butanedioate has a molecular weight of 292.22 g/mol, XLogP of 0.01, 6 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 4-O-fluoro butanedioate is sourced from PubChem (CID 142856537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).