About 4-(1,2-dihydroxyethyl)-2-hydroxy-3-methoxycyclopent-2-en-1-one
4-(1,2-dihydroxyethyl)-2-hydroxy-3-methoxycyclopent-2-en-1-one (PubChem CID 142856652) has the molecular formula C8H12O5
and a molecular weight of 188.18 g/mol. Its IUPAC name is 4-(1,2-dihydroxyethyl)-2-hydroxy-3-methoxycyclopent-2-en-1-one.
Molecular Properties
| Compound Name | 4-(1,2-dihydroxyethyl)-2-hydroxy-3-methoxycyclopent-2-en-1-one |
| PubChem CID | 142856652 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 4-(1,2-dihydroxyethyl)-2-hydroxy-3-methoxycyclopent-2-en-1-one |
| SMILES | COC1=C(O)C(=O)CC1C(O)CO |
| InChI | InChI=1S/C8H12O5/c1-13-8-4(6(11)3-9)2-5(10)7(8)12/h4,6,9,11-12H,2-3H2,1H3 |
| InChIKey | GZMFFEPGJHGNDF-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,2-dihydroxyethyl)-2-hydroxy-3-methoxycyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2-dihydroxyethyl)-2-hydroxy-3-methoxycyclopent-2-en-1-one?
The IUPAC name of 4-(1,2-dihydroxyethyl)-2-hydroxy-3-methoxycyclopent-2-en-1-one (CID 142856652) is 4-(1,2-dihydroxyethyl)-2-hydroxy-3-methoxycyclopent-2-en-1-one.
What is the SMILES notation for 4-(1,2-dihydroxyethyl)-2-hydroxy-3-methoxycyclopent-2-en-1-one?
The canonical SMILES for 4-(1,2-dihydroxyethyl)-2-hydroxy-3-methoxycyclopent-2-en-1-one is COC1=C(O)C(=O)CC1C(O)CO.
What is the InChIKey of 4-(1,2-dihydroxyethyl)-2-hydroxy-3-methoxycyclopent-2-en-1-one?
The InChIKey is GZMFFEPGJHGNDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O5/c1-13-8-4(6(11)3-9)2-5(10)7(8)12/h4,6,9,11-12H,2-3H2,1H3.
What are the key properties of 4-(1,2-dihydroxyethyl)-2-hydroxy-3-methoxycyclopent-2-en-1-one?
4-(1,2-dihydroxyethyl)-2-hydroxy-3-methoxycyclopent-2-en-1-one has a molecular weight of 188.18 g/mol, XLogP of -0.66, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2-dihydroxyethyl)-2-hydroxy-3-methoxycyclopent-2-en-1-one is sourced from PubChem (CID 142856652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).