C15H18O5 — CID 14285668
(3aS,5R,5aR,7R,8aS,9aR)-7,8a-dihydroxy-1,8-dimethylidenespiro[4,5a,6,7,9,9a-hexahydro-3aH-azuleno[6,5-b]furan-5,2'-oxirane]-2-one (PubChem CID 14285668) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (3aS,5R,5aR,7R,8aS,9aR)-7,8a-dihydroxy-1,8-dimethylidenespiro[4,5a,6,7,9,9a-hexahydro-3aH-azuleno[6,5-b]furan-5,2'-oxirane]-2-one.
| Compound Name | (3aS,5R,5aR,7R,8aS,9aR)-7,8a-dihydroxy-1,8-dimethylidenespiro[4,5a,6,7,9,9a-hexahydro-3aH-azuleno[6,5-b]furan-5,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 14285668 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (3aS,5R,5aR,7R,8aS,9aR)-7,8a-dihydroxy-1,8-dimethylidenespiro[4,5a,6,7,9,9a-hexahydro-3aH-azuleno[6,5-b]furan-5,2'-oxirane]-2-one |
| SMILES | C=C1C(=O)O[C@H]2C[C@]3(CO3)[C@@H]3C[C@@H](O)C(=C)[C@]3(O)C[C@H]12 |
| InChI | InChI=1S/C15H18O5/c1-7-9-4-15(18)8(2)10(16)3-12(15)14(6-19-14)5-11(9)20-13(7)17/h9-12,16,18H,1-6H2/t9-,10-,11+,12+,14+,15-/m1/s1 |
| InChIKey | NRQMQZXLJOVXEZ-BBEFNTSISA-N |
| XLogP | 0.32 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|