About (1R)-1-(2,2-dimethyl-3H-furan-5-yl)-2,2-dimethylpropan-1-amine
(1R)-1-(2,2-dimethyl-3H-furan-5-yl)-2,2-dimethylpropan-1-amine (PubChem CID 142856764) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is (1R)-1-(2,2-dimethyl-3H-furan-5-yl)-2,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | (1R)-1-(2,2-dimethyl-3H-furan-5-yl)-2,2-dimethylpropan-1-amine |
| PubChem CID | 142856764 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (1R)-1-(2,2-dimethyl-3H-furan-5-yl)-2,2-dimethylpropan-1-amine |
| SMILES | CC1(C)CC=C([C@H](N)C(C)(C)C)O1 |
| InChI | InChI=1S/C11H21NO/c1-10(2,3)9(12)8-6-7-11(4,5)13-8/h6,9H,7,12H2,1-5H3/t9-/m0/s1 |
| InChIKey | CFLJHULFTPFJCT-VIFPVBQESA-N |
| XLogP | 2.44 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-1-(2,2-dimethyl-3H-furan-5-yl)-2,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(2,2-dimethyl-3H-furan-5-yl)-2,2-dimethylpropan-1-amine?
The IUPAC name of (1R)-1-(2,2-dimethyl-3H-furan-5-yl)-2,2-dimethylpropan-1-amine (CID 142856764) is (1R)-1-(2,2-dimethyl-3H-furan-5-yl)-2,2-dimethylpropan-1-amine.
What is the SMILES notation for (1R)-1-(2,2-dimethyl-3H-furan-5-yl)-2,2-dimethylpropan-1-amine?
The canonical SMILES for (1R)-1-(2,2-dimethyl-3H-furan-5-yl)-2,2-dimethylpropan-1-amine is CC1(C)CC=C([C@H](N)C(C)(C)C)O1.
What is the InChIKey of (1R)-1-(2,2-dimethyl-3H-furan-5-yl)-2,2-dimethylpropan-1-amine?
The InChIKey is CFLJHULFTPFJCT-VIFPVBQESA-N. The full InChI is InChI=1S/C11H21NO/c1-10(2,3)9(12)8-6-7-11(4,5)13-8/h6,9H,7,12H2,1-5H3/t9-/m0/s1.
What are the key properties of (1R)-1-(2,2-dimethyl-3H-furan-5-yl)-2,2-dimethylpropan-1-amine?
(1R)-1-(2,2-dimethyl-3H-furan-5-yl)-2,2-dimethylpropan-1-amine has a molecular weight of 183.29 g/mol, XLogP of 2.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(2,2-dimethyl-3H-furan-5-yl)-2,2-dimethylpropan-1-amine is sourced from PubChem (CID 142856764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).