C10H13N3O2S — CID 142857959
(2E,4Z)-N-hydroxy-5-(1-methylpyrazol-3-yl)-5-methylsulfanylpenta-2,4-dienamide (PubChem CID 142857959) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is (2E,4Z)-N-hydroxy-5-(1-methylpyrazol-3-yl)-5-methylsulfanylpenta-2,4-dienamide.
| Compound Name | (2E,4Z)-N-hydroxy-5-(1-methylpyrazol-3-yl)-5-methylsulfanylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 142857959 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | (2E,4Z)-N-hydroxy-5-(1-methylpyrazol-3-yl)-5-methylsulfanylpenta-2,4-dienamide |
| SMILES | CS/C(=C\C=C\C(=O)NO)c1ccn(C)n1 |
| InChI | InChI=1S/C10H13N3O2S/c1-13-7-6-8(11-13)9(16-2)4-3-5-10(14)12-15/h3-7,15H,1-2H3,(H,12,14)/b5-3+,9-4- |
| InChIKey | DUKILSLENLBOQR-PVOUKABXSA-N |
| XLogP | 1.19 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|