About 2-methanimidoylphenol;2-(pentan-2-yliminomethyl)phenol
2-methanimidoylphenol;2-(pentan-2-yliminomethyl)phenol (PubChem CID 142858114) has the molecular formula C19H24N2O2
and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-methanimidoylphenol;2-(pentan-2-yliminomethyl)phenol.
Molecular Properties
| Compound Name | 2-methanimidoylphenol;2-(pentan-2-yliminomethyl)phenol |
| PubChem CID | 142858114 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 2-methanimidoylphenol;2-(pentan-2-yliminomethyl)phenol |
| SMILES | CCCC(C)/N=C/c1ccccc1O.[H]/N=C/c1ccccc1O |
| InChI | InChI=1S/C12H17NO.C7H7NO/c1-3-6-10(2)13-9-11-7-4-5-8-12(11)14;8-5-6-3-1-2-4-7(6)9/h4-5,7-10,14H,3,6H2,1-2H3;1-5,8-9H/b13-9+;8-5+ |
| InChIKey | FDLIUMVNLRESRU-CPJQREMBSA-N |
| XLogP | 4.39 |
| TPSA | 76.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methanimidoylphenol;2-(pentan-2-yliminomethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanimidoylphenol;2-(pentan-2-yliminomethyl)phenol?
The IUPAC name of 2-methanimidoylphenol;2-(pentan-2-yliminomethyl)phenol (CID 142858114) is 2-methanimidoylphenol;2-(pentan-2-yliminomethyl)phenol.
What is the SMILES notation for 2-methanimidoylphenol;2-(pentan-2-yliminomethyl)phenol?
The canonical SMILES for 2-methanimidoylphenol;2-(pentan-2-yliminomethyl)phenol is CCCC(C)/N=C/c1ccccc1O.[H]/N=C/c1ccccc1O.
What is the InChIKey of 2-methanimidoylphenol;2-(pentan-2-yliminomethyl)phenol?
The InChIKey is FDLIUMVNLRESRU-CPJQREMBSA-N. The full InChI is InChI=1S/C12H17NO.C7H7NO/c1-3-6-10(2)13-9-11-7-4-5-8-12(11)14;8-5-6-3-1-2-4-7(6)9/h4-5,7-10,14H,3,6H2,1-2H3;1-5,8-9H/b13-9+;8-5+.
What are the key properties of 2-methanimidoylphenol;2-(pentan-2-yliminomethyl)phenol?
2-methanimidoylphenol;2-(pentan-2-yliminomethyl)phenol has a molecular weight of 312.41 g/mol, XLogP of 4.39, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanimidoylphenol;2-(pentan-2-yliminomethyl)phenol is sourced from PubChem (CID 142858114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).