C15H26N2 — CID 142858173
(2E,4E,6Z)-5-(4-ethylpiperidin-1-yl)octa-2,4,6-trien-1-amine (PubChem CID 142858173) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is (2E,4E,6Z)-5-(4-ethylpiperidin-1-yl)octa-2,4,6-trien-1-amine.
| Compound Name | (2E,4E,6Z)-5-(4-ethylpiperidin-1-yl)octa-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 142858173 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | (2E,4E,6Z)-5-(4-ethylpiperidin-1-yl)octa-2,4,6-trien-1-amine |
| SMILES | C/C=C\C(=C/C=C/CN)N1CCC(CC)CC1 |
| InChI | InChI=1S/C15H26N2/c1-3-7-15(8-5-6-11-16)17-12-9-14(4-2)10-13-17/h3,5-8,14H,4,9-13,16H2,1-2H3/b6-5+,7-3-,15-8+ |
| InChIKey | VEPMJYFAIQGVPJ-KSQXPXOUSA-N |
| XLogP | 3.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|