C24H39N3O2 — CID 142858822
1-N-heptyl-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,4-dicarboxamide (PubChem CID 142858822) has the molecular formula C24H39N3O2 and a molecular weight of 401.60 g/mol. Its IUPAC name is 1-N-heptyl-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N-heptyl-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 142858822 |
| Molecular Formula | C24H39N3O2 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.30 |
| IUPAC Name | 1-N-heptyl-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,4-dicarboxamide |
| SMILES | CCCCCCCNC(=O)c1ccc(C(=O)NC2CC(C)(C)NC(C)(C)C2)cc1 |
| InChI | InChI=1S/C24H39N3O2/c1-6-7-8-9-10-15-25-21(28)18-11-13-19(14-12-18)22(29)26-20-16-23(2,3)27-24(4,5)17-20/h11-14,20,27H,6-10,15-17H2,1-5H3,(H,25,28)(H,26,29) |
| InChIKey | GCGZSAIEJZNQJB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|