C26H41N3O3 — CID 142858840
1-N-cyclohexyl-4-N-(1-formyl-2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,4-dicarboxamide;ethane (PubChem CID 142858840) has the molecular formula C26H41N3O3 and a molecular weight of 443.63 g/mol. Its IUPAC name is 1-N-cyclohexyl-4-N-(1-formyl-2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,4-dicarboxamide;ethane.
| Compound Name | 1-N-cyclohexyl-4-N-(1-formyl-2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,4-dicarboxamide;ethane |
|---|---|
| PubChem CID | 142858840 |
| Molecular Formula | C26H41N3O3 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.31 |
| IUPAC Name | 1-N-cyclohexyl-4-N-(1-formyl-2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,4-dicarboxamide;ethane |
| SMILES | CC.CC1(C)CC(NC(=O)c2ccc(C(=O)NC3CCCCC3)cc2)CC(C)(C)N1C=O |
| InChI | InChI=1S/C24H35N3O3.C2H6/c1-23(2)14-20(15-24(3,4)27(23)16-28)26-22(30)18-12-10-17(11-13-18)21(29)25-19-8-6-5-7-9-19;1-2/h10-13,16,19-20H,5-9,14-15H2,1-4H3,(H,25,29)(H,26,30);1-2H3 |
| InChIKey | OZGPNTFHEFQCAH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|