C24H39N3O3 — CID 142858845
4-N-heptan-2-yl-1-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,4-dicarboxamide (PubChem CID 142858845) has the molecular formula C24H39N3O3 and a molecular weight of 417.59 g/mol. Its IUPAC name is 4-N-heptan-2-yl-1-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-heptan-2-yl-1-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 142858845 |
| Molecular Formula | C24H39N3O3 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | 4-N-heptan-2-yl-1-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,4-dicarboxamide |
| SMILES | CCCCCC(C)NC(=O)c1ccc(C(=O)NC2CC(C)(C)N(O)C(C)(C)C2)cc1 |
| InChI | InChI=1S/C24H39N3O3/c1-7-8-9-10-17(2)25-21(28)18-11-13-19(14-12-18)22(29)26-20-15-23(3,4)27(30)24(5,6)16-20/h11-14,17,20,30H,7-10,15-16H2,1-6H3,(H,25,28)(H,26,29) |
| InChIKey | UGDCNTNDMQSBPR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|