C24H38O3 — CID 142858890
(1S,4aS)-2-ethyl-1-methyl-2-(2,5,5-trimethyl-1,3-dioxan-2-yl)-1,3,4a,4b,5,6,7,9,10,10a-decahydrophenanthren-4-one (PubChem CID 142858890) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is (1S,4aS)-2-ethyl-1-methyl-2-(2,5,5-trimethyl-1,3-dioxan-2-yl)-1,3,4a,4b,5,6,7,9,10,10a-decahydrophenanthren-4-one.
| Compound Name | (1S,4aS)-2-ethyl-1-methyl-2-(2,5,5-trimethyl-1,3-dioxan-2-yl)-1,3,4a,4b,5,6,7,9,10,10a-decahydrophenanthren-4-one |
|---|---|
| PubChem CID | 142858890 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | (1S,4aS)-2-ethyl-1-methyl-2-(2,5,5-trimethyl-1,3-dioxan-2-yl)-1,3,4a,4b,5,6,7,9,10,10a-decahydrophenanthren-4-one |
| SMILES | CCC1(C2(C)OCC(C)(C)CO2)CC(=O)[C@@H]2C3CCCC=C3CCC2[C@@H]1C |
| InChI | InChI=1S/C24H38O3/c1-6-24(23(5)26-14-22(3,4)15-27-23)13-20(25)21-18(16(24)2)12-11-17-9-7-8-10-19(17)21/h9,16,18-19,21H,6-8,10-15H2,1-5H3/t16-,18?,19?,21-,24?/m0/s1 |
| InChIKey | ADOLNRGYVFNJAN-NQKDNBQJSA-N |
| XLogP | 5.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|